C6H6F6N2 — CID 149273405
1,1,1,5,5,5-hexafluoro-4-methyliminopent-2-en-2-amine (PubChem CID 149273405) has the molecular formula C6H6F6N2 and a molecular weight of 220.12 g/mol. Its IUPAC name is 1,1,1,5,5,5-hexafluoro-4-methyliminopent-2-en-2-amine.
| Compound Name | 1,1,1,5,5,5-hexafluoro-4-methyliminopent-2-en-2-amine |
|---|---|
| PubChem CID | 149273405 |
| Molecular Formula | C6H6F6N2 |
| Molecular Weight | 220.12 g/mol |
| Exact Mass | 220.04 |
| IUPAC Name | 1,1,1,5,5,5-hexafluoro-4-methyliminopent-2-en-2-amine |
| SMILES | C/N=C(/C=C(N)C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H6F6N2/c1-14-4(6(10,11)12)2-3(13)5(7,8)9/h2H,13H2,1H3/b3-2?,14-4- |
| InChIKey | VZWPQUSFDLQXPN-MUCRZPDNSA-N |
| XLogP | 2.02 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.12 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|