C17H16F3N3S — CID 174027479
S-[4-[[3-amino-4,4,4-trifluoro-1-(4-methylphenyl)but-2-enylidene]amino]phenyl]thiohydroxylamine (PubChem CID 174027479) has the molecular formula C17H16F3N3S and a molecular weight of 351.40 g/mol. Its IUPAC name is S-[4-[[3-amino-4,4,4-trifluoro-1-(4-methylphenyl)but-2-enylidene]amino]phenyl]thiohydroxylamine.
| Compound Name | S-[4-[[3-amino-4,4,4-trifluoro-1-(4-methylphenyl)but-2-enylidene]amino]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 174027479 |
| Molecular Formula | C17H16F3N3S |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | S-[4-[[3-amino-4,4,4-trifluoro-1-(4-methylphenyl)but-2-enylidene]amino]phenyl]thiohydroxylamine |
| SMILES | Cc1ccc(/C(C=C(N)C(F)(F)F)=N/c2ccc(SN)cc2)cc1 |
| InChI | InChI=1S/C17H16F3N3S/c1-11-2-4-12(5-3-11)15(10-16(21)17(18,19)20)23-13-6-8-14(24-22)9-7-13/h2-10H,21-22H2,1H3/b16-10?,23-15+ |
| InChIKey | WALNSDBRTWNICS-GQWABCIYSA-N |
| XLogP | 4.49 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|