C27H19NO8 — CID 165394316
[6-(6,7-dimethoxy-3-oxo-1H-benzo[f][2]benzofuran-4-yl)-1,3-benzodioxol-5-yl] pyridine-2-carboxylate (PubChem CID 165394316) has the molecular formula C27H19NO8 and a molecular weight of 485.45 g/mol. Its IUPAC name is [6-(6,7-dimethoxy-3-oxo-1H-benzo[f][2]benzofuran-4-yl)-1,3-benzodioxol-5-yl] pyridine-2-carboxylate.
| Compound Name | [6-(6,7-dimethoxy-3-oxo-1H-benzo[f][2]benzofuran-4-yl)-1,3-benzodioxol-5-yl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 165394316 |
| Molecular Formula | C27H19NO8 |
| Molecular Weight | 485.45 g/mol |
| Exact Mass | 485.11 |
| IUPAC Name | [6-(6,7-dimethoxy-3-oxo-1H-benzo[f][2]benzofuran-4-yl)-1,3-benzodioxol-5-yl] pyridine-2-carboxylate |
| SMILES | COc1cc2cc3c(c(-c4cc5c(cc4OC(=O)c4ccccn4)OCO5)c2cc1OC)C(=O)OC3 |
| InChI | InChI=1S/C27H19NO8/c1-31-20-8-14-7-15-12-33-27(30)24(15)25(16(14)9-21(20)32-2)17-10-22-23(35-13-34-22)11-19(17)36-26(29)18-5-3-4-6-28-18/h3-11H,12-13H2,1-2H3 |
| InChIKey | UIZSIPLBYJJJTK-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 102.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.45 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|