C27H29F2IN4O — CID 165395498
N-[2-[4-(amino-ethyl-oxo-λ5-iodanyl)-6-(4-fluorophenyl)-5-methyl-2-pyridinyl]ethyl]-1-(6-fluoro-4-methyl-1H-indol-2-yl)ethenamine (PubChem CID 165395498) has the molecular formula C27H29F2IN4O and a molecular weight of 590.46 g/mol. Its IUPAC name is N-[2-[4-(amino-ethyl-oxo-λ5-iodanyl)-6-(4-fluorophenyl)-5-methyl-2-pyridinyl]ethyl]-1-(6-fluoro-4-methyl-1H-indol-2-yl)ethenamine.
| Compound Name | N-[2-[4-(amino-ethyl-oxo-λ5-iodanyl)-6-(4-fluorophenyl)-5-methyl-2-pyridinyl]ethyl]-1-(6-fluoro-4-methyl-1H-indol-2-yl)ethenamine |
|---|---|
| PubChem CID | 165395498 |
| Molecular Formula | C27H29F2IN4O |
| Molecular Weight | 590.46 g/mol |
| Exact Mass | 590.14 |
| IUPAC Name | N-[2-[4-(amino-ethyl-oxo-λ5-iodanyl)-6-(4-fluorophenyl)-5-methyl-2-pyridinyl]ethyl]-1-(6-fluoro-4-methyl-1H-indol-2-yl)ethenamine |
| SMILES | C=C(NCCc1cc(I(N)(=O)CC)c(C)c(-c2ccc(F)cc2)n1)c1cc2c(C)cc(F)cc2[nH]1 |
| InChI | InChI=1S/C27H29F2IN4O/c1-5-30(31,35)24-14-22(33-27(17(24)3)19-6-8-20(28)9-7-19)10-11-32-18(4)25-15-23-16(2)12-21(29)13-26(23)34-25/h6-9,12-15,32,34H,4-5,10-11H2,1-3H3,(H2,31,35) |
| InChIKey | IUJSIUKODIGWIV-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 83.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.46 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|