C29H27ClF5N5O2 — CID 165395623
2-chloro-6-(cyclopropyliminomethyl)-4-[1-[[3,3,3-trifluoro-2-[3-fluoro-7-(4-fluorophenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]propyl]amino]ethenyl]aniline;formamide (PubChem CID 165395623) has the molecular formula C29H27ClF5N5O2 and a molecular weight of 608.01 g/mol. Its IUPAC name is 2-chloro-6-(cyclopropyliminomethyl)-4-[1-[[3,3,3-trifluoro-2-[3-fluoro-7-(4-fluorophenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]propyl]amino]ethenyl]aniline;formamide.
| Compound Name | 2-chloro-6-(cyclopropyliminomethyl)-4-[1-[[3,3,3-trifluoro-2-[3-fluoro-7-(4-fluorophenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]propyl]amino]ethenyl]aniline;formamide |
|---|---|
| PubChem CID | 165395623 |
| Molecular Formula | C29H27ClF5N5O2 |
| Molecular Weight | 608.01 g/mol |
| Exact Mass | 607.18 |
| IUPAC Name | 2-chloro-6-(cyclopropyliminomethyl)-4-[1-[[3,3,3-trifluoro-2-[3-fluoro-7-(4-fluorophenyl)-2,3-dihydrofuro[2,3-c]pyridin-5-yl]propyl]amino]ethenyl]aniline;formamide |
| SMILES | C=C(NCC(c1cc2c(c(-c3ccc(F)cc3)n1)OCC2F)C(F)(F)F)c1cc(Cl)c(N)c(/C=N/C2CC2)c1.NC=O |
| InChI | InChI=1S/C28H24ClF5N4O.CH3NO/c1-14(16-8-17(11-37-19-6-7-19)25(35)22(29)9-16)36-12-21(28(32,33)34)24-10-20-23(31)13-39-27(20)26(38-24)15-2-4-18(30)5-3-15;2-1-3/h2-5,8-11,19,21,23,36H,1,6-7,12-13,35H2;1H,(H2,2,3)/b37-11+; |
| InChIKey | XRJUIPYQUVSLNQ-GMZFDKORSA-N |
| XLogP | 6.12 |
| TPSA | 115.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.01 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|