C31H32ClF3N6O4 — CID 164910489
4-[5-[3-[4-amino-3-(cyclopropyliminomethyl)-5-methoxyphenyl]-1,1,1-trifluoropropan-2-yl]-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-7-yl]-2-chlorobenzonitrile;formamide (PubChem CID 164910489) has the molecular formula C31H32ClF3N6O4 and a molecular weight of 645.08 g/mol. Its IUPAC name is 4-[5-[3-[4-amino-3-(cyclopropyliminomethyl)-5-methoxyphenyl]-1,1,1-trifluoropropan-2-yl]-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-7-yl]-2-chlorobenzonitrile;formamide.
| Compound Name | 4-[5-[3-[4-amino-3-(cyclopropyliminomethyl)-5-methoxyphenyl]-1,1,1-trifluoropropan-2-yl]-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-7-yl]-2-chlorobenzonitrile;formamide |
|---|---|
| PubChem CID | 164910489 |
| Molecular Formula | C31H32ClF3N6O4 |
| Molecular Weight | 645.08 g/mol |
| Exact Mass | 644.21 |
| IUPAC Name | 4-[5-[3-[4-amino-3-(cyclopropyliminomethyl)-5-methoxyphenyl]-1,1,1-trifluoropropan-2-yl]-3-methyl-2,3-dihydrofuro[2,3-c]pyridin-7-yl]-2-chlorobenzonitrile;formamide |
| SMILES | COc1cc(CC(c2cc3c(c(-c4ccc(C#N)c(Cl)c4)n2)OCC3C)C(F)(F)F)cc(/C=N/C2CC2)c1N.NC=O.NC=O |
| InChI | InChI=1S/C29H26ClF3N4O2.2CH3NO/c1-15-14-39-28-21(15)11-24(37-27(28)17-3-4-18(12-34)23(30)10-17)22(29(31,32)33)8-16-7-19(13-36-20-5-6-20)26(35)25(9-16)38-2;2*2-1-3/h3-4,7,9-11,13,15,20,22H,5-6,8,14,35H2,1-2H3;2*1H,(H2,2,3)/b36-13+;; |
| InChIKey | GTISIVBOLUOQEY-GSLOSLGVSA-N |
| XLogP | 5.03 |
| TPSA | 179.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.08 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|