About (6-methylquinolin-8-yl) (Z)-but-2-enimidate
(6-methylquinolin-8-yl) (Z)-but-2-enimidate (PubChem CID 165395659) has the molecular formula C14H14N2O
and a molecular weight of 226.28 g/mol. Its IUPAC name is (6-methylquinolin-8-yl) (Z)-but-2-enimidate.
Molecular Properties
| Compound Name | (6-methylquinolin-8-yl) (Z)-but-2-enimidate |
| PubChem CID | 165395659 |
| Molecular Formula | C14H14N2O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | (6-methylquinolin-8-yl) (Z)-but-2-enimidate |
| SMILES | [H]/N=C(\C=C/C)Oc1cc(C)cc2cccnc12 |
| InChI | InChI=1S/C14H14N2O/c1-3-5-13(15)17-12-9-10(2)8-11-6-4-7-16-14(11)12/h3-9,15H,1-2H3/b5-3-,15-13+ |
| InChIKey | PYJGCQWXXTWSGU-QQPYNVQXSA-N |
| XLogP | 3.48 |
| TPSA | 45.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (6-methylquinolin-8-yl) (Z)-but-2-enimidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6-methylquinolin-8-yl) (Z)-but-2-enimidate?
The IUPAC name of (6-methylquinolin-8-yl) (Z)-but-2-enimidate (CID 165395659) is (6-methylquinolin-8-yl) (Z)-but-2-enimidate.
What is the SMILES notation for (6-methylquinolin-8-yl) (Z)-but-2-enimidate?
The canonical SMILES for (6-methylquinolin-8-yl) (Z)-but-2-enimidate is [H]/N=C(\C=C/C)Oc1cc(C)cc2cccnc12.
What is the InChIKey of (6-methylquinolin-8-yl) (Z)-but-2-enimidate?
The InChIKey is PYJGCQWXXTWSGU-QQPYNVQXSA-N. The full InChI is InChI=1S/C14H14N2O/c1-3-5-13(15)17-12-9-10(2)8-11-6-4-7-16-14(11)12/h3-9,15H,1-2H3/b5-3-,15-13+.
What are the key properties of (6-methylquinolin-8-yl) (Z)-but-2-enimidate?
(6-methylquinolin-8-yl) (Z)-but-2-enimidate has a molecular weight of 226.28 g/mol, XLogP of 3.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (6-methylquinolin-8-yl) (Z)-but-2-enimidate is sourced from PubChem (CID 165395659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).