About Mebiquine
Mebiquine (PubChem CID 16683098) has the molecular formula C10H12BiNO3
and a molecular weight of 403.19 g/mol.
Molecular Properties
| Compound Name | Mebiquine |
| PubChem CID | 16683098 |
| Molecular Formula | C10H12BiNO3 |
| Molecular Weight | 403.19 g/mol |
| Exact Mass | 403.06 |
| IUPAC Name | — |
| SMILES | Cc1cc(O[Bi])c2ncccc2c1.O.O |
| InChI | InChI=1S/C10H9NO.Bi.2H2O/c1-7-5-8-3-2-4-11-10(8)9(12)6-7;;;/h2-6,12H,1H3;;2*1H2/q;+1;;/p-1 |
| InChIKey | WYMIHTNPHXUBJE-UHFFFAOYSA-M |
| XLogP | 0.36 |
| TPSA | 85.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 403.19 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Mebiquine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Mebiquine?
The IUPAC name of Mebiquine (CID 16683098) is not available.
What is the SMILES notation for Mebiquine?
The canonical SMILES for Mebiquine is Cc1cc(O[Bi])c2ncccc2c1.O.O.
What is the InChIKey of Mebiquine?
The InChIKey is WYMIHTNPHXUBJE-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H9NO.Bi.2H2O/c1-7-5-8-3-2-4-11-10(8)9(12)6-7;;;/h2-6,12H,1H3;;2*1H2/q;+1;;/p-1.
What are the key properties of Mebiquine?
Mebiquine has a molecular weight of 403.19 g/mol, XLogP of 0.36, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Mebiquine is sourced from PubChem (CID 16683098), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).