About ethane;8-methoxy-6-methylquinoline;methyl formate
ethane;8-methoxy-6-methylquinoline;methyl formate (PubChem CID 156896164) has the molecular formula C15H21NO3
and a molecular weight of 263.34 g/mol. Its IUPAC name is ethane;8-methoxy-6-methylquinoline;methyl formate.
Molecular Properties
| Compound Name | ethane;8-methoxy-6-methylquinoline;methyl formate |
| PubChem CID | 156896164 |
| Molecular Formula | C15H21NO3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | ethane;8-methoxy-6-methylquinoline;methyl formate |
| SMILES | CC.COC=O.COc1cc(C)cc2cccnc12 |
| InChI | InChI=1S/C11H11NO.C2H4O2.C2H6/c1-8-6-9-4-3-5-12-11(9)10(7-8)13-2;1-4-2-3;1-2/h3-7H,1-2H3;2H,1H3;1-2H3 |
| InChIKey | DYCPCVBOYSXQMG-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;8-methoxy-6-methylquinoline;methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;8-methoxy-6-methylquinoline;methyl formate?
The IUPAC name of ethane;8-methoxy-6-methylquinoline;methyl formate (CID 156896164) is ethane;8-methoxy-6-methylquinoline;methyl formate.
What is the SMILES notation for ethane;8-methoxy-6-methylquinoline;methyl formate?
The canonical SMILES for ethane;8-methoxy-6-methylquinoline;methyl formate is CC.COC=O.COc1cc(C)cc2cccnc12.
What is the InChIKey of ethane;8-methoxy-6-methylquinoline;methyl formate?
The InChIKey is DYCPCVBOYSXQMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO.C2H4O2.C2H6/c1-8-6-9-4-3-5-12-11(9)10(7-8)13-2;1-4-2-3;1-2/h3-7H,1-2H3;2H,1H3;1-2H3.
What are the key properties of ethane;8-methoxy-6-methylquinoline;methyl formate?
ethane;8-methoxy-6-methylquinoline;methyl formate has a molecular weight of 263.34 g/mol, XLogP of 3.37, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;8-methoxy-6-methylquinoline;methyl formate is sourced from PubChem (CID 156896164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).