C12H13NO — CID 58053088
8-methoxy-4,6-dimethylquinoline (PubChem CID 58053088) has the molecular formula C12H13NO and a molecular weight of 187.24 g/mol. Its IUPAC name is 8-methoxy-4,6-dimethylquinoline.
| Compound Name | 8-methoxy-4,6-dimethylquinoline |
|---|---|
| PubChem CID | 58053088 |
| Molecular Formula | C12H13NO |
| Molecular Weight | 187.24 g/mol |
| Exact Mass | 187.10 |
| IUPAC Name | 8-methoxy-4,6-dimethylquinoline |
| SMILES | COc1cc(C)cc2c(C)ccnc12 |
| InChI | InChI=1S/C12H13NO/c1-8-6-10-9(2)4-5-13-12(10)11(7-8)14-3/h4-7H,1-3H3 |
| InChIKey | JMFKXWYZFADUDP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.24 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |