C12H10LiNO2 — CID 118691351
lithium 4,6-dimethylquinoline-8-carboxylate (PubChem CID 118691351) has the molecular formula C12H10LiNO2 and a molecular weight of 207.16 g/mol. Its IUPAC name is lithium 4,6-dimethylquinoline-8-carboxylate.
| Compound Name | lithium 4,6-dimethylquinoline-8-carboxylate |
|---|---|
| PubChem CID | 118691351 |
| Molecular Formula | C12H10LiNO2 |
| Molecular Weight | 207.16 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | lithium 4,6-dimethylquinoline-8-carboxylate |
| SMILES | Cc1cc(C(=O)[O-])c2nccc(C)c2c1.[Li+] |
| InChI | InChI=1S/C12H11NO2.Li/c1-7-5-9-8(2)3-4-13-11(9)10(6-7)12(14)15;/h3-6H,1-2H3,(H,14,15);/q;+1/p-1 |
| InChIKey | TWNJDFFROTYQDC-UHFFFAOYSA-M |
| XLogP | -1.78 |
| TPSA | 53.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.16 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |