C19H23N3O3 — CID 16539849
[2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl] pyridine-2-carboxylate (PubChem CID 16539849) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is [2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl] pyridine-2-carboxylate.
| Compound Name | [2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl] pyridine-2-carboxylate |
|---|---|
| PubChem CID | 16539849 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | [2-[4-[ethyl(propan-2-yl)amino]anilino]-2-oxoethyl] pyridine-2-carboxylate |
| SMILES | CCN(c1ccc(NC(=O)COC(=O)c2ccccn2)cc1)C(C)C |
| InChI | InChI=1S/C19H23N3O3/c1-4-22(14(2)3)16-10-8-15(9-11-16)21-18(23)13-25-19(24)17-7-5-6-12-20-17/h5-12,14H,4,13H2,1-3H3,(H,21,23) |
| InChIKey | QJTUZFWWIBWOOC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |