C14H19N5 — CID 165399452
(3Z)-4-(2,4-dimethylindazol-5-yl)-3-methylbuta-1,3-diene-1,1,4-triamine (PubChem CID 165399452) has the molecular formula C14H19N5 and a molecular weight of 257.34 g/mol. Its IUPAC name is (3Z)-4-(2,4-dimethylindazol-5-yl)-3-methylbuta-1,3-diene-1,1,4-triamine.
| Compound Name | (3Z)-4-(2,4-dimethylindazol-5-yl)-3-methylbuta-1,3-diene-1,1,4-triamine |
|---|---|
| PubChem CID | 165399452 |
| Molecular Formula | C14H19N5 |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | (3Z)-4-(2,4-dimethylindazol-5-yl)-3-methylbuta-1,3-diene-1,1,4-triamine |
| SMILES | C/C(C=C(N)N)=C(/N)c1ccc2nn(C)cc2c1C |
| InChI | InChI=1S/C14H19N5/c1-8(6-13(15)16)14(17)10-4-5-12-11(9(10)2)7-19(3)18-12/h4-7H,15-17H2,1-3H3/b14-8- |
| InChIKey | CHBGRGQGIPJMII-ZSOIEALJSA-N |
| XLogP | 1.33 |
| TPSA | 95.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|