C13H22N2 — CID 90974355
2,4-dimethylindazole;ethane (PubChem CID 90974355) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 2,4-dimethylindazole;ethane.
| Compound Name | 2,4-dimethylindazole;ethane |
|---|---|
| PubChem CID | 90974355 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 2,4-dimethylindazole;ethane |
| SMILES | CC.CC.Cc1cccc2nn(C)cc12 |
| InChI | InChI=1S/C9H10N2.2C2H6/c1-7-4-3-5-9-8(7)6-11(2)10-9;2*1-2/h3-6H,1-2H3;2*1-2H3 |
| InChIKey | SZWUTRICZLNZLA-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |