C24H28FN5O6 — CID 165400606
tert-butyl N-[5-fluoro-6-[2-[4-methoxy-3-(1-methylpyrazol-3-yl)-5-nitrophenyl]ethoxymethyl]-2-pyridinyl]carbamate (PubChem CID 165400606) has the molecular formula C24H28FN5O6 and a molecular weight of 501.52 g/mol. Its IUPAC name is tert-butyl N-[5-fluoro-6-[2-[4-methoxy-3-(1-methylpyrazol-3-yl)-5-nitrophenyl]ethoxymethyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[5-fluoro-6-[2-[4-methoxy-3-(1-methylpyrazol-3-yl)-5-nitrophenyl]ethoxymethyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 165400606 |
| Molecular Formula | C24H28FN5O6 |
| Molecular Weight | 501.52 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | tert-butyl N-[5-fluoro-6-[2-[4-methoxy-3-(1-methylpyrazol-3-yl)-5-nitrophenyl]ethoxymethyl]-2-pyridinyl]carbamate |
| SMILES | COc1c(-c2ccn(C)n2)cc(CCOCc2nc(NC(=O)OC(C)(C)C)ccc2F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H28FN5O6/c1-24(2,3)36-23(31)27-21-7-6-17(25)19(26-21)14-35-11-9-15-12-16(18-8-10-29(4)28-18)22(34-5)20(13-15)30(32)33/h6-8,10,12-13H,9,11,14H2,1-5H3,(H,26,27,31) |
| InChIKey | LAQBQMSBZOCDGY-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 130.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.52 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|