C24H29N5O7S — CID 175803848
tert-butyl N-[6-[2-[4-methoxy-3-(1-methylpyrazol-3-yl)-5-nitrophenyl]ethylsulfonylmethyl]-2-pyridinyl]carbamate (PubChem CID 175803848) has the molecular formula C24H29N5O7S and a molecular weight of 531.59 g/mol. Its IUPAC name is tert-butyl N-[6-[2-[4-methoxy-3-(1-methylpyrazol-3-yl)-5-nitrophenyl]ethylsulfonylmethyl]-2-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-[2-[4-methoxy-3-(1-methylpyrazol-3-yl)-5-nitrophenyl]ethylsulfonylmethyl]-2-pyridinyl]carbamate |
|---|---|
| PubChem CID | 175803848 |
| Molecular Formula | C24H29N5O7S |
| Molecular Weight | 531.59 g/mol |
| Exact Mass | 531.18 |
| IUPAC Name | tert-butyl N-[6-[2-[4-methoxy-3-(1-methylpyrazol-3-yl)-5-nitrophenyl]ethylsulfonylmethyl]-2-pyridinyl]carbamate |
| SMILES | COc1c(-c2ccn(C)n2)cc(CCS(=O)(=O)Cc2cccc(NC(=O)OC(C)(C)C)n2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H29N5O7S/c1-24(2,3)36-23(30)26-21-8-6-7-17(25-21)15-37(33,34)12-10-16-13-18(19-9-11-28(4)27-19)22(35-5)20(14-16)29(31)32/h6-9,11,13-14H,10,12,15H2,1-5H3,(H,25,26,30) |
| InChIKey | KSYLRRFFDGKMIG-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 155.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.59 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|