C27H29BrFN3O7 — CID 171437460
tert-butyl N-[6-[(3-bromo-4-methoxy-5-nitrophenyl)methoxymethyl]-5-fluoro-2-pyridinyl]-N-[(4-methoxyphenyl)methyl]carbamate (PubChem CID 171437460) has the molecular formula C27H29BrFN3O7 and a molecular weight of 606.45 g/mol. Its IUPAC name is tert-butyl N-[6-[(3-bromo-4-methoxy-5-nitrophenyl)methoxymethyl]-5-fluoro-2-pyridinyl]-N-[(4-methoxyphenyl)methyl]carbamate.
| Compound Name | tert-butyl N-[6-[(3-bromo-4-methoxy-5-nitrophenyl)methoxymethyl]-5-fluoro-2-pyridinyl]-N-[(4-methoxyphenyl)methyl]carbamate |
|---|---|
| PubChem CID | 171437460 |
| Molecular Formula | C27H29BrFN3O7 |
| Molecular Weight | 606.45 g/mol |
| Exact Mass | 605.12 |
| IUPAC Name | tert-butyl N-[6-[(3-bromo-4-methoxy-5-nitrophenyl)methoxymethyl]-5-fluoro-2-pyridinyl]-N-[(4-methoxyphenyl)methyl]carbamate |
| SMILES | COc1ccc(CN(C(=O)OC(C)(C)C)c2ccc(F)c(COCc3cc(Br)c(OC)c([N+](=O)[O-])c3)n2)cc1 |
| InChI | InChI=1S/C27H29BrFN3O7/c1-27(2,3)39-26(33)31(14-17-6-8-19(36-4)9-7-17)24-11-10-21(29)22(30-24)16-38-15-18-12-20(28)25(37-5)23(13-18)32(34)35/h6-13H,14-16H2,1-5H3 |
| InChIKey | XNISTQPHEXIUFG-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 113.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.45 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|