C24H25FN2O8 — CID 176807989
methyl 5-fluoro-2-[(E)-3-[(4-methoxyphenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-oxoprop-1-enyl]-3-nitrobenzoate (PubChem CID 176807989) has the molecular formula C24H25FN2O8 and a molecular weight of 488.47 g/mol. Its IUPAC name is methyl 5-fluoro-2-[(E)-3-[(4-methoxyphenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-oxoprop-1-enyl]-3-nitrobenzoate.
| Compound Name | methyl 5-fluoro-2-[(E)-3-[(4-methoxyphenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-oxoprop-1-enyl]-3-nitrobenzoate |
|---|---|
| PubChem CID | 176807989 |
| Molecular Formula | C24H25FN2O8 |
| Molecular Weight | 488.47 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | methyl 5-fluoro-2-[(E)-3-[(4-methoxyphenyl)methyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]-3-oxoprop-1-enyl]-3-nitrobenzoate |
| SMILES | COC(=O)c1cc(F)cc([N+](=O)[O-])c1/C=C/C(=O)N(Cc1ccc(OC)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C24H25FN2O8/c1-24(2,3)35-23(30)26(14-15-6-8-17(33-4)9-7-15)21(28)11-10-18-19(22(29)34-5)12-16(25)13-20(18)27(31)32/h6-13H,14H2,1-5H3/b11-10+ |
| InChIKey | YNPAKPCRLROCMF-ZHACJKMWSA-N |
| XLogP | 4.51 |
| TPSA | 125.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.47 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|