C18H28N2O5S — CID 160959785
tert-butyl N-[(4-methoxyphenyl)methyl-[(2S)-pent-4-en-2-yl]sulfamoyl]carbamate (PubChem CID 160959785) has the molecular formula C18H28N2O5S and a molecular weight of 384.50 g/mol. Its IUPAC name is tert-butyl N-[(4-methoxyphenyl)methyl-[(2S)-pent-4-en-2-yl]sulfamoyl]carbamate.
| Compound Name | tert-butyl N-[(4-methoxyphenyl)methyl-[(2S)-pent-4-en-2-yl]sulfamoyl]carbamate |
|---|---|
| PubChem CID | 160959785 |
| Molecular Formula | C18H28N2O5S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | tert-butyl N-[(4-methoxyphenyl)methyl-[(2S)-pent-4-en-2-yl]sulfamoyl]carbamate |
| SMILES | C=CC[C@H](C)N(Cc1ccc(OC)cc1)S(=O)(=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H28N2O5S/c1-7-8-14(2)20(13-15-9-11-16(24-6)12-10-15)26(22,23)19-17(21)25-18(3,4)5/h7,9-12,14H,1,8,13H2,2-6H3,(H,19,21)/t14-/m0/s1 |
| InChIKey | SWWDBCPAFYVNNX-AWEZNQCLSA-N |
| XLogP | 3.23 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|