C23H29NO5S — CID 157182119
methyl (2S)-2-[(4-methoxyphenyl)methyl-[(4-methylphenyl)methyl]sulfamoyl]-2-methylpent-4-enoate (PubChem CID 157182119) has the molecular formula C23H29NO5S and a molecular weight of 431.55 g/mol. Its IUPAC name is methyl (2S)-2-[(4-methoxyphenyl)methyl-[(4-methylphenyl)methyl]sulfamoyl]-2-methylpent-4-enoate.
| Compound Name | methyl (2S)-2-[(4-methoxyphenyl)methyl-[(4-methylphenyl)methyl]sulfamoyl]-2-methylpent-4-enoate |
|---|---|
| PubChem CID | 157182119 |
| Molecular Formula | C23H29NO5S |
| Molecular Weight | 431.55 g/mol |
| Exact Mass | 431.18 |
| IUPAC Name | methyl (2S)-2-[(4-methoxyphenyl)methyl-[(4-methylphenyl)methyl]sulfamoyl]-2-methylpent-4-enoate |
| SMILES | C=CC[C@@](C)(C(=O)OC)S(=O)(=O)N(Cc1ccc(C)cc1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H29NO5S/c1-6-15-23(3,22(25)29-5)30(26,27)24(16-19-9-7-18(2)8-10-19)17-20-11-13-21(28-4)14-12-20/h6-14H,1,15-17H2,2-5H3/t23-/m0/s1 |
| InChIKey | NXJQEFPJSAYQDZ-QHCPKHFHSA-N |
| XLogP | 3.84 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.55 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|