About (2R)-1-methoxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-2-sulfonamide
(2R)-1-methoxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-2-sulfonamide (PubChem CID 162456454) has the molecular formula C23H31NO5S
and a molecular weight of 433.57 g/mol. Its IUPAC name is (2R)-1-methoxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-2-sulfonamide.
Molecular Properties
| Compound Name | (2R)-1-methoxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-2-sulfonamide |
| PubChem CID | 162456454 |
| Molecular Formula | C23H31NO5S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | (2R)-1-methoxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-2-sulfonamide |
| SMILES | C=CC[C@](C)(COC)S(=O)(=O)N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H31NO5S/c1-6-15-23(2,18-27-3)30(25,26)24(16-19-7-11-21(28-4)12-8-19)17-20-9-13-22(29-5)14-10-20/h6-14H,1,15-18H2,2-5H3/t23-/m1/s1 |
| InChIKey | CTFHFCUAMAXHSR-HSZRJFAPSA-N |
| XLogP | 4.02 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R)-1-methoxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-1-methoxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-2-sulfonamide?
The IUPAC name of (2R)-1-methoxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-2-sulfonamide (CID 162456454) is (2R)-1-methoxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-2-sulfonamide.
What is the SMILES notation for (2R)-1-methoxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-2-sulfonamide?
The canonical SMILES for (2R)-1-methoxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-2-sulfonamide is C=CC[C@](C)(COC)S(=O)(=O)N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1.
What is the InChIKey of (2R)-1-methoxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-2-sulfonamide?
The InChIKey is CTFHFCUAMAXHSR-HSZRJFAPSA-N. The full InChI is InChI=1S/C23H31NO5S/c1-6-15-23(2,18-27-3)30(25,26)24(16-19-7-11-21(28-4)12-8-19)17-20-9-13-22(29-5)14-10-20/h6-14H,1,15-18H2,2-5H3/t23-/m1/s1.
What are the key properties of (2R)-1-methoxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-2-sulfonamide?
(2R)-1-methoxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-2-sulfonamide has a molecular weight of 433.57 g/mol, XLogP of 4.02, 12 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-1-methoxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-2-sulfonamide is sourced from PubChem (CID 162456454), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).