C23H31NO5S — CID 162456454
(2R)-1-methoxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-2-sulfonamide (PubChem CID 162456454) has the molecular formula C23H31NO5S and a molecular weight of 433.57 g/mol. Its IUPAC name is (2R)-1-methoxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-2-sulfonamide.
| Compound Name | (2R)-1-methoxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-2-sulfonamide |
|---|---|
| PubChem CID | 162456454 |
| Molecular Formula | C23H31NO5S |
| Molecular Weight | 433.57 g/mol |
| Exact Mass | 433.19 |
| IUPAC Name | (2R)-1-methoxy-N,N-bis[(4-methoxyphenyl)methyl]-2-methylpent-4-ene-2-sulfonamide |
| SMILES | C=CC[C@](C)(COC)S(=O)(=O)N(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1 |
| InChI | InChI=1S/C23H31NO5S/c1-6-15-23(2,18-27-3)30(25,26)24(16-19-7-11-21(28-4)12-8-19)17-20-9-13-22(29-5)14-10-20/h6-14H,1,15-18H2,2-5H3/t23-/m1/s1 |
| InChIKey | CTFHFCUAMAXHSR-HSZRJFAPSA-N |
| XLogP | 4.02 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|