C27H32CsNO6 — CID 132557558
cesium (Z)-1-ethoxy-2-[(4-methoxyphenyl)methyl-[(E)-4-[(2-methylpropan-2-yl)oxy]-4-oxobut-2-enoyl]amino]-3-phenylprop-1-en-1-olate (PubChem CID 132557558) has the molecular formula C27H32CsNO6 and a molecular weight of 599.46 g/mol. Its IUPAC name is cesium (Z)-1-ethoxy-2-[(4-methoxyphenyl)methyl-[(E)-4-[(2-methylpropan-2-yl)oxy]-4-oxobut-2-enoyl]amino]-3-phenylprop-1-en-1-olate.
| Compound Name | cesium (Z)-1-ethoxy-2-[(4-methoxyphenyl)methyl-[(E)-4-[(2-methylpropan-2-yl)oxy]-4-oxobut-2-enoyl]amino]-3-phenylprop-1-en-1-olate |
|---|---|
| PubChem CID | 132557558 |
| Molecular Formula | C27H32CsNO6 |
| Molecular Weight | 599.46 g/mol |
| Exact Mass | 599.13 |
| IUPAC Name | cesium (Z)-1-ethoxy-2-[(4-methoxyphenyl)methyl-[(E)-4-[(2-methylpropan-2-yl)oxy]-4-oxobut-2-enoyl]amino]-3-phenylprop-1-en-1-olate |
| SMILES | CCO/C([O-])=C(/Cc1ccccc1)N(Cc1ccc(OC)cc1)C(=O)/C=C/C(=O)OC(C)(C)C.[Cs+] |
| InChI | InChI=1S/C27H33NO6.Cs/c1-6-33-26(31)23(18-20-10-8-7-9-11-20)28(19-21-12-14-22(32-5)15-13-21)24(29)16-17-25(30)34-27(2,3)4;/h7-17,31H,6,18-19H2,1-5H3;/q;+1/p-1/b17-16+,26-23-; |
| InChIKey | SUUOPWZCFCBCPF-YJEAQPHPSA-M |
| XLogP | 0.73 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.46 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|