C29H42BClN2O6 — CID 165400854
tert-butyl N-tert-butyl-N-[1-[7-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-1-yl]-2-methylpropan-2-yl]oxycarbonylcarbamate (PubChem CID 165400854) has the molecular formula C29H42BClN2O6 and a molecular weight of 560.93 g/mol. Its IUPAC name is tert-butyl N-tert-butyl-N-[1-[7-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-1-yl]-2-methylpropan-2-yl]oxycarbonylcarbamate.
| Compound Name | tert-butyl N-tert-butyl-N-[1-[7-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-1-yl]-2-methylpropan-2-yl]oxycarbonylcarbamate |
|---|---|
| PubChem CID | 165400854 |
| Molecular Formula | C29H42BClN2O6 |
| Molecular Weight | 560.93 g/mol |
| Exact Mass | 560.28 |
| IUPAC Name | tert-butyl N-tert-butyl-N-[1-[7-chloro-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoquinolin-1-yl]-2-methylpropan-2-yl]oxycarbonylcarbamate |
| SMILES | CC(C)(C)OC(=O)N(C(=O)OC(C)(C)Cc1ncc(B2OC(C)(C)C(C)(C)O2)c2ccc(Cl)cc12)C(C)(C)C |
| InChI | InChI=1S/C29H42BClN2O6/c1-25(2,3)33(23(34)36-26(4,5)6)24(35)37-27(7,8)16-22-20-15-18(31)13-14-19(20)21(17-32-22)30-38-28(9,10)29(11,12)39-30/h13-15,17H,16H2,1-12H3 |
| InChIKey | HHVIJPZYRFFVLL-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 87.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.93 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|