C17H25BN2O2S — CID 165402539
CID 165402539 (PubChem CID 165402539) has the molecular formula C17H25BN2O2S and a molecular weight of 332.28 g/mol.
| Compound Name | CID 165402539 |
|---|---|
| PubChem CID | 165402539 |
| Molecular Formula | C17H25BN2O2S |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.17 |
| IUPAC Name | — |
| SMILES | CC.CC.[B]c1ccc(-c2nc(C(C)(C)NC(=O)O)cs2)cc1 |
| InChI | InChI=1S/C13H13BN2O2S.2C2H6/c1-13(2,16-12(17)18)10-7-19-11(15-10)8-3-5-9(14)6-4-8;2*1-2/h3-7,16H,1-2H3,(H,17,18);2*1-2H3 |
| InChIKey | XEOPTQGEGARKJS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|