C16H17NO2S — CID 170872178
(E)-3-[4-(4-tert-butyl-1,3-thiazol-2-yl)phenyl]prop-2-enoic acid (PubChem CID 170872178) has the molecular formula C16H17NO2S and a molecular weight of 287.38 g/mol. Its IUPAC name is (E)-3-[4-(4-tert-butyl-1,3-thiazol-2-yl)phenyl]prop-2-enoic acid.
| Compound Name | (E)-3-[4-(4-tert-butyl-1,3-thiazol-2-yl)phenyl]prop-2-enoic acid |
|---|---|
| PubChem CID | 170872178 |
| Molecular Formula | C16H17NO2S |
| Molecular Weight | 287.38 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | (E)-3-[4-(4-tert-butyl-1,3-thiazol-2-yl)phenyl]prop-2-enoic acid |
| SMILES | CC(C)(C)c1csc(-c2ccc(/C=C/C(=O)O)cc2)n1 |
| InChI | InChI=1S/C16H17NO2S/c1-16(2,3)13-10-20-15(17-13)12-7-4-11(5-8-12)6-9-14(18)19/h4-10H,1-3H3,(H,18,19)/b9-6+ |
| InChIKey | AKYMIDVFLRGPDT-RMKNXTFCSA-N |
| XLogP | 4.21 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|