C21H19ClN2O2S — CID 2820585
[[4-(4-tert-butyl-1,3-thiazol-2-yl)phenyl]methylideneamino] 2-chlorobenzoate (PubChem CID 2820585) has the molecular formula C21H19ClN2O2S and a molecular weight of 398.92 g/mol. Its IUPAC name is [[4-(4-tert-butyl-1,3-thiazol-2-yl)phenyl]methylideneamino] 2-chlorobenzoate.
| Compound Name | [[4-(4-tert-butyl-1,3-thiazol-2-yl)phenyl]methylideneamino] 2-chlorobenzoate |
|---|---|
| PubChem CID | 2820585 |
| Molecular Formula | C21H19ClN2O2S |
| Molecular Weight | 398.92 g/mol |
| Exact Mass | 398.09 |
| IUPAC Name | [[4-(4-tert-butyl-1,3-thiazol-2-yl)phenyl]methylideneamino] 2-chlorobenzoate |
| SMILES | CC(C)(C)c1csc(-c2ccc(C=NOC(=O)c3ccccc3Cl)cc2)n1 |
| InChI | InChI=1S/C21H19ClN2O2S/c1-21(2,3)18-13-27-19(24-18)15-10-8-14(9-11-15)12-23-26-20(25)16-6-4-5-7-17(16)22/h4-13H,1-3H3 |
| InChIKey | ASOVQOOXWBPZLO-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 51.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.92 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|