About [(Z)-(4-bromophenyl)methylideneamino] 2-methylbenzoate
[(Z)-(4-bromophenyl)methylideneamino] 2-methylbenzoate (PubChem CID 5396246) has the molecular formula C15H12BrNO2
and a molecular weight of 318.17 g/mol. Its IUPAC name is [(Z)-(4-bromophenyl)methylideneamino] 2-methylbenzoate.
Molecular Properties
| Compound Name | [(Z)-(4-bromophenyl)methylideneamino] 2-methylbenzoate |
| PubChem CID | 5396246 |
| Molecular Formula | C15H12BrNO2 |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 317.01 |
| IUPAC Name | [(Z)-(4-bromophenyl)methylideneamino] 2-methylbenzoate |
| SMILES | Cc1ccccc1C(=O)O/N=C\c1ccc(Br)cc1 |
| InChI | InChI=1S/C15H12BrNO2/c1-11-4-2-3-5-14(11)15(18)19-17-10-12-6-8-13(16)9-7-12/h2-10H,1H3/b17-10- |
| InChIKey | RXDVUWKPQXCPNF-YVLHZVERSA-N |
| XLogP | 3.95 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [(Z)-(4-bromophenyl)methylideneamino] 2-methylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(Z)-(4-bromophenyl)methylideneamino] 2-methylbenzoate?
The IUPAC name of [(Z)-(4-bromophenyl)methylideneamino] 2-methylbenzoate (CID 5396246) is [(Z)-(4-bromophenyl)methylideneamino] 2-methylbenzoate.
What is the SMILES notation for [(Z)-(4-bromophenyl)methylideneamino] 2-methylbenzoate?
The canonical SMILES for [(Z)-(4-bromophenyl)methylideneamino] 2-methylbenzoate is Cc1ccccc1C(=O)O/N=C\c1ccc(Br)cc1.
What is the InChIKey of [(Z)-(4-bromophenyl)methylideneamino] 2-methylbenzoate?
The InChIKey is RXDVUWKPQXCPNF-YVLHZVERSA-N. The full InChI is InChI=1S/C15H12BrNO2/c1-11-4-2-3-5-14(11)15(18)19-17-10-12-6-8-13(16)9-7-12/h2-10H,1H3/b17-10-.
What are the key properties of [(Z)-(4-bromophenyl)methylideneamino] 2-methylbenzoate?
[(Z)-(4-bromophenyl)methylideneamino] 2-methylbenzoate has a molecular weight of 318.17 g/mol, XLogP of 3.95, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(Z)-(4-bromophenyl)methylideneamino] 2-methylbenzoate is sourced from PubChem (CID 5396246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).