C10H10ClF2N3O — CID 165402864
2-[2-chloro-4-[(3S,4S)-3,4-difluoropyrrolidin-1-yl]pyrimidin-5-yl]acetaldehyde (PubChem CID 165402864) has the molecular formula C10H10ClF2N3O and a molecular weight of 261.66 g/mol. Its IUPAC name is 2-[2-chloro-4-[(3S,4S)-3,4-difluoropyrrolidin-1-yl]pyrimidin-5-yl]acetaldehyde.
| Compound Name | 2-[2-chloro-4-[(3S,4S)-3,4-difluoropyrrolidin-1-yl]pyrimidin-5-yl]acetaldehyde |
|---|---|
| PubChem CID | 165402864 |
| Molecular Formula | C10H10ClF2N3O |
| Molecular Weight | 261.66 g/mol |
| Exact Mass | 261.05 |
| IUPAC Name | 2-[2-chloro-4-[(3S,4S)-3,4-difluoropyrrolidin-1-yl]pyrimidin-5-yl]acetaldehyde |
| SMILES | O=CCc1cnc(Cl)nc1N1C[C@H](F)[C@@H](F)C1 |
| InChI | InChI=1S/C10H10ClF2N3O/c11-10-14-3-6(1-2-17)9(15-10)16-4-7(12)8(13)5-16/h2-3,7-8H,1,4-5H2/t7-,8-/m0/s1 |
| InChIKey | UWTOJGRMGVFVFF-YUMQZZPRSA-N |
| XLogP | 1.37 |
| TPSA | 46.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.66 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|