About 2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetic acid;2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetonitrile
2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetic acid;2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetonitrile (PubChem CID 165402933) has the molecular formula C20H19F2N3O2
and a molecular weight of 371.39 g/mol. Its IUPAC name is 2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetic acid;2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetonitrile.
Molecular Properties
| Compound Name | 2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetic acid;2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetonitrile |
| PubChem CID | 165402933 |
| Molecular Formula | C20H19F2N3O2 |
| Molecular Weight | 371.39 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetic acid;2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetonitrile |
| SMILES | N#CCc1cnc(C2CC2)c(F)c1.O=C(O)Cc1cnc(C2CC2)c(F)c1 |
| InChI | InChI=1S/C10H9FN2.C10H10FNO2/c11-9-5-7(3-4-12)6-13-10(9)8-1-2-8;11-8-3-6(4-9(13)14)5-12-10(8)7-1-2-7/h5-6,8H,1-3H2;3,5,7H,1-2,4H2,(H,13,14) |
| InChIKey | GPSIPUPFAZUFAR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 86.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 371.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetic acid;2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetic acid;2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetonitrile?
The IUPAC name of 2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetic acid;2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetonitrile (CID 165402933) is 2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetic acid;2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetonitrile.
What is the SMILES notation for 2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetic acid;2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetonitrile?
The canonical SMILES for 2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetic acid;2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetonitrile is N#CCc1cnc(C2CC2)c(F)c1.O=C(O)Cc1cnc(C2CC2)c(F)c1.
What is the InChIKey of 2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetic acid;2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetonitrile?
The InChIKey is GPSIPUPFAZUFAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9FN2.C10H10FNO2/c11-9-5-7(3-4-12)6-13-10(9)8-1-2-8;11-8-3-6(4-9(13)14)5-12-10(8)7-1-2-7/h5-6,8H,1-3H2;3,5,7H,1-2,4H2,(H,13,14).
What are the key properties of 2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetic acid;2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetonitrile?
2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetic acid;2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetonitrile has a molecular weight of 371.39 g/mol, XLogP of 3.89, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetic acid;2-(6-cyclopropyl-5-fluoro-3-pyridinyl)acetonitrile is sourced from PubChem (CID 165402933), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).