C8H12N4 — CID 165402995
4-[(1Z)-2-aminobuta-1,3-dienyl]-1-methylpyrazol-5-amine (PubChem CID 165402995) has the molecular formula C8H12N4 and a molecular weight of 164.21 g/mol. Its IUPAC name is 4-[(1Z)-2-aminobuta-1,3-dienyl]-1-methylpyrazol-5-amine.
| Compound Name | 4-[(1Z)-2-aminobuta-1,3-dienyl]-1-methylpyrazol-5-amine |
|---|---|
| PubChem CID | 165402995 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 4-[(1Z)-2-aminobuta-1,3-dienyl]-1-methylpyrazol-5-amine |
| SMILES | C=C/C(N)=C/c1cnn(C)c1N |
| InChI | InChI=1S/C8H12N4/c1-3-7(9)4-6-5-11-12(2)8(6)10/h3-5H,1,9-10H2,2H3/b7-4- |
| InChIKey | ZENQUMMCGLGDKX-DAXSKMNVSA-N |
| XLogP | 0.49 |
| TPSA | 69.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|