C8H9N3 — CID 123366036
1-methyl-6H-pyrazolo[5,4-b]azepine (PubChem CID 123366036) has the molecular formula C8H9N3 and a molecular weight of 147.18 g/mol. Its IUPAC name is 1-methyl-6H-pyrazolo[5,4-b]azepine.
| Compound Name | 1-methyl-6H-pyrazolo[5,4-b]azepine |
|---|---|
| PubChem CID | 123366036 |
| Molecular Formula | C8H9N3 |
| Molecular Weight | 147.18 g/mol |
| Exact Mass | 147.08 |
| IUPAC Name | 1-methyl-6H-pyrazolo[5,4-b]azepine |
| SMILES | Cn1ncc2c1N=CCC=C2 |
| InChI | InChI=1S/C8H9N3/c1-11-8-7(6-10-11)4-2-3-5-9-8/h2,4-6H,3H2,1H3 |
| InChIKey | HTOAVOKSTQTQOZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.18 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |