C9H12N2 — CID 143224012
1-methyl-4-[(1Z,3Z)-penta-1,3-dienyl]pyrazole (PubChem CID 143224012) has the molecular formula C9H12N2 and a molecular weight of 148.21 g/mol. Its IUPAC name is 1-methyl-4-[(1Z,3Z)-penta-1,3-dienyl]pyrazole.
| Compound Name | 1-methyl-4-[(1Z,3Z)-penta-1,3-dienyl]pyrazole |
|---|---|
| PubChem CID | 143224012 |
| Molecular Formula | C9H12N2 |
| Molecular Weight | 148.21 g/mol |
| Exact Mass | 148.10 |
| IUPAC Name | 1-methyl-4-[(1Z,3Z)-penta-1,3-dienyl]pyrazole |
| SMILES | C/C=C\C=C/c1cnn(C)c1 |
| InChI | InChI=1S/C9H12N2/c1-3-4-5-6-9-7-10-11(2)8-9/h3-8H,1-2H3/b4-3-,6-5- |
| InChIKey | MKZSILOJYPJQOT-OUPQRBNQSA-N |
| XLogP | 2.01 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.21 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|