C9H12N3+ — CID 123999754
1,8-dimethyl-6H-pyrazolo[5,4-b]azepin-8-ium (PubChem CID 123999754) has the molecular formula C9H12N3+ and a molecular weight of 162.22 g/mol. Its IUPAC name is 1,8-dimethyl-6H-pyrazolo[5,4-b]azepin-8-ium.
| Compound Name | 1,8-dimethyl-6H-pyrazolo[5,4-b]azepin-8-ium |
|---|---|
| PubChem CID | 123999754 |
| Molecular Formula | C9H12N3+ |
| Molecular Weight | 162.22 g/mol |
| Exact Mass | 162.10 |
| IUPAC Name | 1,8-dimethyl-6H-pyrazolo[5,4-b]azepin-8-ium |
| SMILES | Cn1ncc2c1[N+](C)=CCC=C2 |
| InChI | InChI=1S/C9H12N3/c1-11-6-4-3-5-8-7-10-12(2)9(8)11/h3,5-7H,4H2,1-2H3/q+1 |
| InChIKey | OBLXHLNUMMXJCM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 20.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.22 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|