C9H15N3 — CID 143402529
ethane;1-methyl-6,7-dihydropyrazolo[5,4-b]pyridine (PubChem CID 143402529) has the molecular formula C9H15N3 and a molecular weight of 165.24 g/mol. Its IUPAC name is ethane;1-methyl-6,7-dihydropyrazolo[5,4-b]pyridine.
| Compound Name | ethane;1-methyl-6,7-dihydropyrazolo[5,4-b]pyridine |
|---|---|
| PubChem CID | 143402529 |
| Molecular Formula | C9H15N3 |
| Molecular Weight | 165.24 g/mol |
| Exact Mass | 165.13 |
| IUPAC Name | ethane;1-methyl-6,7-dihydropyrazolo[5,4-b]pyridine |
| SMILES | CC.Cn1ncc2c1NCC=C2 |
| InChI | InChI=1S/C7H9N3.C2H6/c1-10-7-6(5-9-10)3-2-4-8-7;1-2/h2-3,5,8H,4H2,1H3;1-2H3 |
| InChIKey | KHTUJJSVYHYYEU-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 165.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |