C10H17N3 — CID 144888681
1-[(Z)-but-1-enyl]-N,N,4-trimethylpyrazol-5-amine (PubChem CID 144888681) has the molecular formula C10H17N3 and a molecular weight of 179.27 g/mol. Its IUPAC name is 1-[(Z)-but-1-enyl]-N,N,4-trimethylpyrazol-5-amine.
| Compound Name | 1-[(Z)-but-1-enyl]-N,N,4-trimethylpyrazol-5-amine |
|---|---|
| PubChem CID | 144888681 |
| Molecular Formula | C10H17N3 |
| Molecular Weight | 179.27 g/mol |
| Exact Mass | 179.14 |
| IUPAC Name | 1-[(Z)-but-1-enyl]-N,N,4-trimethylpyrazol-5-amine |
| SMILES | CC/C=C\n1ncc(C)c1N(C)C |
| InChI | InChI=1S/C10H17N3/c1-5-6-7-13-10(12(3)4)9(2)8-11-13/h6-8H,5H2,1-4H3/b7-6- |
| InChIKey | RPHNGWIIORVDSZ-SREVYHEPSA-N |
| XLogP | 2.14 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.27 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |