C8H8N4 — CID 23127919
1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraene (PubChem CID 23127919) has the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. Its IUPAC name is 1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraene.
| Compound Name | 1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraene |
|---|---|
| PubChem CID | 23127919 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 1,2,6,8-tetrazatricyclo[6.3.1.04,12]dodeca-2,4(12),6,10-tetraene |
| SMILES | C1=Cn2ncc3c2N(C=NC3)C1 |
| InChI | InChI=1S/C8H8N4/c1-2-11-6-9-4-7-5-10-12(3-1)8(7)11/h1,3,5-6H,2,4H2 |
| InChIKey | VFKNWBYCFZKYKE-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 33.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |