C40H36BN5O3 — CID 165406338
4-(23,24-dihydroporphyrin-5-yl)-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]benzamide (PubChem CID 165406338) has the molecular formula C40H36BN5O3 and a molecular weight of 645.57 g/mol. Its IUPAC name is 4-(23,24-dihydroporphyrin-5-yl)-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]benzamide.
| Compound Name | 4-(23,24-dihydroporphyrin-5-yl)-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]benzamide |
|---|---|
| PubChem CID | 165406338 |
| Molecular Formula | C40H36BN5O3 |
| Molecular Weight | 645.57 g/mol |
| Exact Mass | 645.29 |
| IUPAC Name | 4-(23,24-dihydroporphyrin-5-yl)-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methyl]benzamide |
| SMILES | CC1(C)OB(c2ccc(CNC(=O)c3ccc(-c4c5nc(cc6ccc(cc7ccc(cc8nc4C=C8)[nH]7)[nH]6)C=C5)cc3)cc2)OC1(C)C |
| InChI | InChI=1S/C40H36BN5O3/c1-39(2)40(3,4)49-41(48-39)28-11-5-25(6-12-28)24-42-38(47)27-9-7-26(8-10-27)37-35-19-17-33(45-35)22-31-15-13-29(43-31)21-30-14-16-32(44-30)23-34-18-20-36(37)46-34/h5-23,43-44H,24H2,1-4H3,(H,42,47)/b29-21-,30-21-,31-22-,32-23-,33-22-,34-23-,37-35-,37-36- |
| InChIKey | PPNZOAQUZANNGI-KPWFUAEASA-N |
| XLogP | 7.55 |
| TPSA | 104.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.57 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|