C20H16B2FN5O6 — CID 165406400
CID 165406400 (PubChem CID 165406400) has the molecular formula C20H16B2FN5O6 and a molecular weight of 463.00 g/mol.
| Compound Name | CID 165406400 |
|---|---|
| PubChem CID | 165406400 |
| Molecular Formula | C20H16B2FN5O6 |
| Molecular Weight | 463.00 g/mol |
| Exact Mass | 463.13 |
| IUPAC Name | — |
| SMILES | [B]C([B])(F)C(O)(O)Oc1ccc(COc2cnc3c(c2)CN(c2ccc(=O)n(C)n2)C3=O)nc1 |
| InChI | InChI=1S/C20H16B2FN5O6/c1-27-16(29)5-4-15(26-27)28-9-11-6-14(8-25-17(11)18(28)30)33-10-12-2-3-13(7-24-12)34-20(31,32)19(21,22)23/h2-8,31-32H,9-10H2,1H3 |
| InChIKey | FBCDILUDZYQLAQ-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 139.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.00 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|