C7H10INO3 — CID 165408487
1-(1-iodoethylcarbamoyl)cyclopropane-1-carboxylic acid (PubChem CID 165408487) has the molecular formula C7H10INO3 and a molecular weight of 283.06 g/mol. Its IUPAC name is 1-(1-iodoethylcarbamoyl)cyclopropane-1-carboxylic acid.
| Compound Name | 1-(1-iodoethylcarbamoyl)cyclopropane-1-carboxylic acid |
|---|---|
| PubChem CID | 165408487 |
| Molecular Formula | C7H10INO3 |
| Molecular Weight | 283.06 g/mol |
| Exact Mass | 282.97 |
| IUPAC Name | 1-(1-iodoethylcarbamoyl)cyclopropane-1-carboxylic acid |
| SMILES | CC(I)NC(=O)C1(C(=O)O)CC1 |
| InChI | InChI=1S/C7H10INO3/c1-4(8)9-5(10)7(2-3-7)6(11)12/h4H,2-3H2,1H3,(H,9,10)(H,11,12) |
| InChIKey | OCLNDRZRLWCBKU-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.06 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|