C21H27N3O — CID 165413733
N-(1-adamantylmethyl)-2,6-dimethylimidazo[1,2-a]pyridine-3-carboxamide (PubChem CID 165413733) has the molecular formula C21H27N3O and a molecular weight of 337.47 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-2,6-dimethylimidazo[1,2-a]pyridine-3-carboxamide.
| Compound Name | N-(1-adamantylmethyl)-2,6-dimethylimidazo[1,2-a]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 165413733 |
| Molecular Formula | C21H27N3O |
| Molecular Weight | 337.47 g/mol |
| Exact Mass | 337.22 |
| IUPAC Name | N-(1-adamantylmethyl)-2,6-dimethylimidazo[1,2-a]pyridine-3-carboxamide |
| SMILES | Cc1ccc2nc(C)c(C(=O)NCC34CC5CC(CC(C5)C3)C4)n2c1 |
| InChI | InChI=1S/C21H27N3O/c1-13-3-4-18-23-14(2)19(24(18)11-13)20(25)22-12-21-8-15-5-16(9-21)7-17(6-15)10-21/h3-4,11,15-17H,5-10,12H2,1-2H3,(H,22,25) |
| InChIKey | ICMKOXRHHDXMIP-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.47 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |