C20H21N5O — CID 165414446
N-[(3R)-1-cyanopyrrolidin-3-yl]-6-(3,4-dihydro-1H-isoquinolin-2-yl)pyridine-2-carboxamide (PubChem CID 165414446) has the molecular formula C20H21N5O and a molecular weight of 347.42 g/mol. Its IUPAC name is N-[(3R)-1-cyanopyrrolidin-3-yl]-6-(3,4-dihydro-1H-isoquinolin-2-yl)pyridine-2-carboxamide.
| Compound Name | N-[(3R)-1-cyanopyrrolidin-3-yl]-6-(3,4-dihydro-1H-isoquinolin-2-yl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 165414446 |
| Molecular Formula | C20H21N5O |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | N-[(3R)-1-cyanopyrrolidin-3-yl]-6-(3,4-dihydro-1H-isoquinolin-2-yl)pyridine-2-carboxamide |
| SMILES | N#CN1CC[C@@H](NC(=O)c2cccc(N3CCc4ccccc4C3)n2)C1 |
| InChI | InChI=1S/C20H21N5O/c21-14-24-10-9-17(13-24)22-20(26)18-6-3-7-19(23-18)25-11-8-15-4-1-2-5-16(15)12-25/h1-7,17H,8-13H2,(H,22,26)/t17-/m1/s1 |
| InChIKey | PQLWLVGEAZJHNL-QGZVFWFLSA-N |
| XLogP | 1.93 |
| TPSA | 72.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|