C19H22N4O2 — CID 84570614
6-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-formamidopropyl)pyridine-2-carboxamide (PubChem CID 84570614) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is 6-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-formamidopropyl)pyridine-2-carboxamide.
| Compound Name | 6-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-formamidopropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 84570614 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 6-(3,4-dihydro-1H-isoquinolin-2-yl)-N-(3-formamidopropyl)pyridine-2-carboxamide |
| SMILES | O=CNCCCNC(=O)c1cccc(N2CCc3ccccc3C2)n1 |
| InChI | InChI=1S/C19H22N4O2/c24-14-20-10-4-11-21-19(25)17-7-3-8-18(22-17)23-12-9-15-5-1-2-6-16(15)13-23/h1-3,5-8,14H,4,9-13H2,(H,20,24)(H,21,25) |
| InChIKey | DDTAOWGAWZDTNZ-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|