C19H28F4O4Si — CID 165415809
(3S,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-4-phenylmethoxy-3-(trifluoromethyl)oxolan-2-ol (PubChem CID 165415809) has the molecular formula C19H28F4O4Si and a molecular weight of 424.51 g/mol. Its IUPAC name is (3S,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-4-phenylmethoxy-3-(trifluoromethyl)oxolan-2-ol.
| Compound Name | (3S,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-4-phenylmethoxy-3-(trifluoromethyl)oxolan-2-ol |
|---|---|
| PubChem CID | 165415809 |
| Molecular Formula | C19H28F4O4Si |
| Molecular Weight | 424.51 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | (3S,4R,5R)-5-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-fluoro-4-phenylmethoxy-3-(trifluoromethyl)oxolan-2-ol |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1OC(O)[C@](F)(C(F)(F)F)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C19H28F4O4Si/c1-17(2,3)28(4,5)26-12-14-15(25-11-13-9-7-6-8-10-13)18(20,16(24)27-14)19(21,22)23/h6-10,14-16,24H,11-12H2,1-5H3/t14-,15-,16?,18+/m1/s1 |
| InChIKey | ZLMVLBCBPKKZQE-QYFVKBAZSA-N |
| XLogP | 4.58 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.51 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|