C12H12F4O3 — CID 134857658
(5S)-3,3,4,4-tetrafluoro-5-(phenylmethoxymethyl)oxolan-2-ol (PubChem CID 134857658) has the molecular formula C12H12F4O3 and a molecular weight of 280.22 g/mol. Its IUPAC name is (5S)-3,3,4,4-tetrafluoro-5-(phenylmethoxymethyl)oxolan-2-ol.
| Compound Name | (5S)-3,3,4,4-tetrafluoro-5-(phenylmethoxymethyl)oxolan-2-ol |
|---|---|
| PubChem CID | 134857658 |
| Molecular Formula | C12H12F4O3 |
| Molecular Weight | 280.22 g/mol |
| Exact Mass | 280.07 |
| IUPAC Name | (5S)-3,3,4,4-tetrafluoro-5-(phenylmethoxymethyl)oxolan-2-ol |
| SMILES | OC1O[C@@H](COCc2ccccc2)C(F)(F)C1(F)F |
| InChI | InChI=1S/C12H12F4O3/c13-11(14)9(19-10(17)12(11,15)16)7-18-6-8-4-2-1-3-5-8/h1-5,9-10,17H,6-7H2/t9-,10?/m0/s1 |
| InChIKey | MUIWYDDNRZNSPV-RGURZIINSA-N |
| XLogP | 2.19 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.22 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|