C21H18F5NO3 — CID 165415849
[methyl-(4-methylidene-6-phenylhexanoyl)amino] 2,3,4,5,6-pentafluorobenzoate (PubChem CID 165415849) has the molecular formula C21H18F5NO3 and a molecular weight of 427.37 g/mol. Its IUPAC name is [methyl-(4-methylidene-6-phenylhexanoyl)amino] 2,3,4,5,6-pentafluorobenzoate.
| Compound Name | [methyl-(4-methylidene-6-phenylhexanoyl)amino] 2,3,4,5,6-pentafluorobenzoate |
|---|---|
| PubChem CID | 165415849 |
| Molecular Formula | C21H18F5NO3 |
| Molecular Weight | 427.37 g/mol |
| Exact Mass | 427.12 |
| IUPAC Name | [methyl-(4-methylidene-6-phenylhexanoyl)amino] 2,3,4,5,6-pentafluorobenzoate |
| SMILES | C=C(CCC(=O)N(C)OC(=O)c1c(F)c(F)c(F)c(F)c1F)CCc1ccccc1 |
| InChI | InChI=1S/C21H18F5NO3/c1-12(8-10-13-6-4-3-5-7-13)9-11-14(28)27(2)30-21(29)15-16(22)18(24)20(26)19(25)17(15)23/h3-7H,1,8-11H2,2H3 |
| InChIKey | MFTNQLWHJDMCHA-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.37 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|