C24H22N2O3S2 — CID 16541847
5-cyclopropyl-2-[2-(4-methoxyphenoxy)ethylsulfanyl]-3-phenylthieno[2,3-d]pyrimidin-4-one (PubChem CID 16541847) has the molecular formula C24H22N2O3S2 and a molecular weight of 450.59 g/mol. Its IUPAC name is 5-cyclopropyl-2-[2-(4-methoxyphenoxy)ethylsulfanyl]-3-phenylthieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-cyclopropyl-2-[2-(4-methoxyphenoxy)ethylsulfanyl]-3-phenylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 16541847 |
| Molecular Formula | C24H22N2O3S2 |
| Molecular Weight | 450.59 g/mol |
| Exact Mass | 450.11 |
| IUPAC Name | 5-cyclopropyl-2-[2-(4-methoxyphenoxy)ethylsulfanyl]-3-phenylthieno[2,3-d]pyrimidin-4-one |
| SMILES | COc1ccc(OCCSc2nc3scc(C4CC4)c3c(=O)n2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H22N2O3S2/c1-28-18-9-11-19(12-10-18)29-13-14-30-24-25-22-21(20(15-31-22)16-7-8-16)23(27)26(24)17-5-3-2-4-6-17/h2-6,9-12,15-16H,7-8,13-14H2,1H3 |
| InChIKey | BRJZLVQRYKLOFT-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.59 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|