C16H24N4 — CID 165419010
2-butyl-5-[1-(cyclopentylmethyl)imidazol-2-yl]-1H-imidazole (PubChem CID 165419010) has the molecular formula C16H24N4 and a molecular weight of 272.40 g/mol. Its IUPAC name is 2-butyl-5-[1-(cyclopentylmethyl)imidazol-2-yl]-1H-imidazole.
| Compound Name | 2-butyl-5-[1-(cyclopentylmethyl)imidazol-2-yl]-1H-imidazole |
|---|---|
| PubChem CID | 165419010 |
| Molecular Formula | C16H24N4 |
| Molecular Weight | 272.40 g/mol |
| Exact Mass | 272.20 |
| IUPAC Name | 2-butyl-5-[1-(cyclopentylmethyl)imidazol-2-yl]-1H-imidazole |
| SMILES | CCCCc1ncc(-c2nccn2CC2CCCC2)[nH]1 |
| InChI | InChI=1S/C16H24N4/c1-2-3-8-15-18-11-14(19-15)16-17-9-10-20(16)12-13-6-4-5-7-13/h9-11,13H,2-8,12H2,1H3,(H,18,19) |
| InChIKey | QEBLEJYPXXLQQJ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 46.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |