C18H24N2O3 — CID 165421867
(3S,8aS)-2-[2-(2,3-dimethylphenoxy)ethyl]-3-methyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione (PubChem CID 165421867) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is (3S,8aS)-2-[2-(2,3-dimethylphenoxy)ethyl]-3-methyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione.
| Compound Name | (3S,8aS)-2-[2-(2,3-dimethylphenoxy)ethyl]-3-methyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
|---|---|
| PubChem CID | 165421867 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | (3S,8aS)-2-[2-(2,3-dimethylphenoxy)ethyl]-3-methyl-6,7,8,8a-tetrahydro-3H-pyrrolo[1,2-a]pyrazine-1,4-dione |
| SMILES | Cc1cccc(OCCN2C(=O)[C@@H]3CCCN3C(=O)[C@@H]2C)c1C |
| InChI | InChI=1S/C18H24N2O3/c1-12-6-4-8-16(13(12)2)23-11-10-19-14(3)17(21)20-9-5-7-15(20)18(19)22/h4,6,8,14-15H,5,7,9-11H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | DAHYNLJVWWUXEN-GJZGRUSLSA-N |
| XLogP | 1.90 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |