C25H37N3O3S — CID 165422987
N,N,12,16-tetramethyl-9-phenyl-2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(14),15,17-triene-5-sulfonamide (PubChem CID 165422987) has the molecular formula C25H37N3O3S and a molecular weight of 459.66 g/mol. Its IUPAC name is N,N,12,16-tetramethyl-9-phenyl-2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(14),15,17-triene-5-sulfonamide.
| Compound Name | N,N,12,16-tetramethyl-9-phenyl-2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(14),15,17-triene-5-sulfonamide |
|---|---|
| PubChem CID | 165422987 |
| Molecular Formula | C25H37N3O3S |
| Molecular Weight | 459.66 g/mol |
| Exact Mass | 459.26 |
| IUPAC Name | N,N,12,16-tetramethyl-9-phenyl-2-oxa-5,12-diazabicyclo[12.4.0]octadeca-1(14),15,17-triene-5-sulfonamide |
| SMILES | Cc1ccc2c(c1)CN(C)CCC(c1ccccc1)CCCN(S(=O)(=O)N(C)C)CCO2 |
| InChI | InChI=1S/C25H37N3O3S/c1-21-12-13-25-24(19-21)20-27(4)16-14-23(22-9-6-5-7-10-22)11-8-15-28(17-18-31-25)32(29,30)26(2)3/h5-7,9-10,12-13,19,23H,8,11,14-18,20H2,1-4H3 |
| InChIKey | MRZVBOYORJCQBB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.66 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |