C22H26N4O3 — CID 165424147
2-(3-methylphenyl)-N-[[(1S,5S,6R,7R)-3-(1H-pyrazole-5-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]acetamide (PubChem CID 165424147) has the molecular formula C22H26N4O3 and a molecular weight of 394.48 g/mol. Its IUPAC name is 2-(3-methylphenyl)-N-[[(1S,5S,6R,7R)-3-(1H-pyrazole-5-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]acetamide.
| Compound Name | 2-(3-methylphenyl)-N-[[(1S,5S,6R,7R)-3-(1H-pyrazole-5-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]acetamide |
|---|---|
| PubChem CID | 165424147 |
| Molecular Formula | C22H26N4O3 |
| Molecular Weight | 394.48 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | 2-(3-methylphenyl)-N-[[(1S,5S,6R,7R)-3-(1H-pyrazole-5-carbonyl)-10-oxa-3-azatricyclo[5.2.1.01,5]decan-6-yl]methyl]acetamide |
| SMILES | Cc1cccc(CC(=O)NC[C@H]2[C@H]3CN(C(=O)c4ccn[nH]4)C[C@]34CC[C@H]2O4)c1 |
| InChI | InChI=1S/C22H26N4O3/c1-14-3-2-4-15(9-14)10-20(27)23-11-16-17-12-26(21(28)18-6-8-24-25-18)13-22(17)7-5-19(16)29-22/h2-4,6,8-9,16-17,19H,5,7,10-13H2,1H3,(H,23,27)(H,24,25)/t16-,17+,19+,22+/m0/s1 |
| InChIKey | XGVWNQZQJNUJCP-ODULNIPZSA-N |
| XLogP | 1.70 |
| TPSA | 87.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.48 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |